EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H34O16 |
| Net Charge | 0 |
| Average Mass | 638.575 |
| Monoisotopic Mass | 638.18469 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)cc3o2)cc(OC)c1O |
| InChI | InChI=1S/C29H34O16/c1-10-21(33)24(36)26(38)28(41-10)45-27-25(37)23(35)19(9-30)44-29(27)42-12-6-13(31)20-14(32)8-15(43-16(20)7-12)11-4-17(39-2)22(34)18(5-11)40-3/h4-8,10,19,21,23-31,33-38H,9H2,1-3H3/t10-,19+,21-,23+,24+,25-,26+,27+,28-,29+/m0/s1 |
| InChIKey | AIBMPOJXBGZIPQ-QWNFCSOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS287) | ||
| seed (BTO:0001226) | PubMed (26860358) | ||
| Saccharum officinarum (ncbitaxon:4547) | - | PubMed (17019935) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricin 7-O-neohesperidoside (CHEBI:131777) has functional parent 3',5'-di-O-methyltricetin (CHEBI:59979) |
| tricin 7-O-neohesperidoside (CHEBI:131777) has role plant metabolite (CHEBI:76924) |
| tricin 7-O-neohesperidoside (CHEBI:131777) is a dihydroxyflavone (CHEBI:38686) |
| tricin 7-O-neohesperidoside (CHEBI:131777) is a dimethoxyflavone (CHEBI:23798) |
| tricin 7-O-neohesperidoside (CHEBI:131777) is a glycosyloxyflavone (CHEBI:50018) |
| tricin 7-O-neohesperidoside (CHEBI:131777) is a neohesperidoside (CHEBI:25495) |
| tricin 7-O-neohesperidoside (CHEBI:131777) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxo-4H-1-benzopyran-7-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 7-O-[α-L-rhamnopyranosyl-(1→2)-β-D-glucopyranosyl]tricin | ChEBI |
| 7-O-[α-L-rhamnosyl-(1→2)-β-D-glucosyl]tricin | ChEBI |
| Tricin 7-neohesperidoside | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C00004462 | KNApSAcK |
| HMDB0037462 | HMDB |
| LMPK12110862 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5843908 | Reaxys |
| CAS:53766-40-8 | KNApSAcK |
| Citations |
|---|