EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131776 - tricin 7-O-β-D-glucoside
| Formula | C23H24O12 |
| Net Charge | 0 |
| Average Mass | 492.433 |
| Monoisotopic Mass | 492.12678 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc3o2)cc(OC)c1O |
| InChI | InChI=1S/C23H24O12/c1-31-15-3-9(4-16(32-2)19(15)27)13-7-12(26)18-11(25)5-10(6-14(18)34-13)33-23-22(30)21(29)20(28)17(8-24)35-23/h3-7,17,20-25,27-30H,8H2,1-2H3/t17-,20-,21+,22-,23-/m1/s1 |
| InChIKey | JGXFMIJHKASCIZ-LDBVRRDLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS286) | ||
| seed (BTO:0001226) | PubMed (26860358) | ||
| Salsola collina (ncbitaxon:525237) | whole plant (BTO:0001461) | PubMed (17511147) | |
| Setaria vindis (ncbitaxon:4556) | aerial part (BTO:0001658) | PubMed (12135101) | |
| Laodelphax striatella (ncbitaxon:195883) | - | PubMed (11204184) | |
| Emilia sonchifolia (ncbitaxon:415160) | aerial part (BTO:0001658) | PubMed (23397723) | |
| Arenaria kansuensis (ncbitaxon:645710) | - | PubMed (17655145) | |
| Lygodium japonicum (ncbitaxon:13824) | - | PubMed (18619266) | |
| Indocalamus latifolius (ncbitaxon:280852) | - | PubMed (25345133) | |
| Sedum sarmentosum (ncbitaxon:91146) | - | PubMed (22085682) | |
| Trigonella foenum-graecum (ncbitaxon:78534) | - | PubMed (11599360) | |
| Sasa borealis (ncbitaxon:591242) | leaf (BTO:0000713) | PubMed (MED:17366736) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricin 7-O-β-D-glucoside (CHEBI:131776) has functional parent 3',5'-di-O-methyltricetin (CHEBI:59979) |
| tricin 7-O-β-D-glucoside (CHEBI:131776) has role plant metabolite (CHEBI:76924) |
| tricin 7-O-β-D-glucoside (CHEBI:131776) has role radical scavenger (CHEBI:48578) |
| tricin 7-O-β-D-glucoside (CHEBI:131776) has role xenobiotic metabolite (CHEBI:76206) |
| tricin 7-O-β-D-glucoside (CHEBI:131776) is a dihydroxyflavone (CHEBI:38686) |
| tricin 7-O-β-D-glucoside (CHEBI:131776) is a dimethoxyflavone (CHEBI:23798) |
| tricin 7-O-β-D-glucoside (CHEBI:131776) is a glycosyloxyflavone (CHEBI:50018) |
| tricin 7-O-β-D-glucoside (CHEBI:131776) is a monosaccharide derivative (CHEBI:63367) |
| tricin 7-O-β-D-glucoside (CHEBI:131776) is a polyphenol (CHEBI:26195) |
| tricin 7-O-β-D-glucoside (CHEBI:131776) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxo-4H-1-benzopyran-7-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 7-O-β-D-glucosyltricin | ChEBI |
| tricin 7-β-D-glucoside | ChEBI |
| 7-O-β-D-glucopyranosyltricin | ChEBI |
| tricin 7-O-β-D-glucopyranoside | ChEBI |
| 7-glucosyltricin | ChEBI |
| tricin 7-β-glucoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00004444 | KNApSAcK |
| HMDB0030553 | HMDB |
| LMPK12110860 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4832028 | Reaxys |
| CAS:32769-01-0 | KNApSAcK |
| Citations |
|---|