EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O12 |
| Net Charge | 0 |
| Average Mass | 492.433 |
| Monoisotopic Mass | 492.12678 |
| SMILES | COc1cc(-c2cc(=O)c3c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)cc3o2)cc(OC)c1O |
| InChI | InChI=1S/C23H24O12/c1-31-15-3-9(4-16(32-2)19(15)27)12-7-11(26)18-13(33-12)5-10(25)6-14(18)34-23-22(30)21(29)20(28)17(8-24)35-23/h3-7,17,20-25,27-30H,8H2,1-2H3/t17-,20-,21+,22-,23-/m1/s1 |
| InChIKey | FLSOTPIEFVBPBU-LDBVRRDLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS286) | ||
| seed (BTO:0001226) | PubMed (26860358) | ||
| Sasa kurilensis (ncbitaxon:121784) | leaf (BTO:0000713) | PubMed (18262577) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricin 5-O-β-D-glucoside (CHEBI:131775) has functional parent 3',5'-di-O-methyltricetin (CHEBI:59979) |
| tricin 5-O-β-D-glucoside (CHEBI:131775) has role plant metabolite (CHEBI:76924) |
| tricin 5-O-β-D-glucoside (CHEBI:131775) is a dihydroxyflavone (CHEBI:38686) |
| tricin 5-O-β-D-glucoside (CHEBI:131775) is a dimethoxyflavone (CHEBI:23798) |
| tricin 5-O-β-D-glucoside (CHEBI:131775) is a glycosyloxyflavone (CHEBI:50018) |
| tricin 5-O-β-D-glucoside (CHEBI:131775) is a monosaccharide derivative (CHEBI:63367) |
| tricin 5-O-β-D-glucoside (CHEBI:131775) is a polyphenol (CHEBI:26195) |
| tricin 5-O-β-D-glucoside (CHEBI:131775) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 7-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxo-4H-1-benzopyran-5-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 5-O-glucosyltricin | ChEBI |
| 5-O-β-glucosyltricin | ChEBI |
| 5-O-β-D-glucopyranosyltricin | ChEBI |
| 5-O-β-D-glucosyltricin | ChEBI |
| 5-glucosyltricin | ChEBI |
| tricin 5-O-β-D-glucopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00004461 | KNApSAcK |
| LMPK12110861 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5681756 | Reaxys |
| CAS:32769-00-9 | KNApSAcK |
| Citations |
|---|