EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36O16 |
| Net Charge | 0 |
| Average Mass | 688.635 |
| Monoisotopic Mass | 688.20034 |
| SMILES | COc1cc([C@@H](O)[C@H](CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)Oc2c(OC)cc(-c3cc(=O)c4c(O)cc(O)cc4o3)cc2OC)ccc1O |
| InChI | InChI=1S/C33H36O16/c1-43-21-6-14(4-5-17(21)36)28(39)26(13-46-33-31(42)30(41)29(40)25(12-34)49-33)48-32-23(44-2)7-15(8-24(32)45-3)20-11-19(38)27-18(37)9-16(35)10-22(27)47-20/h4-11,25-26,28-31,33-37,39-42H,12-13H2,1-3H3/t25-,26+,28-,29-,30+,31-,33-/m1/s1 |
| InChIKey | WTKUHKWWAMSHEE-XBQYKTMKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS287) | ||
| seed (BTO:0001226) | PubMed (26860358) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricin 4'-O-(erythro-β-guaiacylglyceryl) ether 9''-O-β-D-glucopyranoside (CHEBI:131773) has functional parent (−)-(7R,8S)-guaiacylglycerol (CHEBI:67645) |
| tricin 4'-O-(erythro-β-guaiacylglyceryl) ether 9''-O-β-D-glucopyranoside (CHEBI:131773) has functional parent 3',5'-di-O-methyltricetin (CHEBI:59979) |
| tricin 4'-O-(erythro-β-guaiacylglyceryl) ether 9''-O-β-D-glucopyranoside (CHEBI:131773) has role plant metabolite (CHEBI:76924) |
| tricin 4'-O-(erythro-β-guaiacylglyceryl) ether 9''-O-β-D-glucopyranoside (CHEBI:131773) is a dihydroxyflavone (CHEBI:38686) |
| tricin 4'-O-(erythro-β-guaiacylglyceryl) ether 9''-O-β-D-glucopyranoside (CHEBI:131773) is a dimethoxyflavone (CHEBI:23798) |
| tricin 4'-O-(erythro-β-guaiacylglyceryl) ether 9''-O-β-D-glucopyranoside (CHEBI:131773) is a monosaccharide derivative (CHEBI:63367) |
| tricin 4'-O-(erythro-β-guaiacylglyceryl) ether 9''-O-β-D-glucopyranoside (CHEBI:131773) is a polyphenol (CHEBI:26195) |
| tricin 4'-O-(erythro-β-guaiacylglyceryl) ether 9''-O-β-D-glucopyranoside (CHEBI:131773) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (2S,3R)-2-[4-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-2-yl)-2,6-dimethoxyphenoxy]-3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propyl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26681636 | Reaxys |
| Citations |
|---|