EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26O15 |
| Net Charge | 0 |
| Average Mass | 578.479 |
| Monoisotopic Mass | 578.12717 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(O[C@@H]4O[C@H](COC(=O)CC(=O)O)[C@@H](O)[C@H](O)[C@H]4O)cc3o2)cc(OC)c1O |
| InChI | InChI=1S/C26H26O15/c1-36-16-3-10(4-17(37-2)22(16)32)14-7-13(28)21-12(27)5-11(6-15(21)40-14)39-26-25(35)24(34)23(33)18(41-26)9-38-20(31)8-19(29)30/h3-7,18,23-27,32-35H,8-9H2,1-2H3,(H,29,30)/t18-,23-,24+,25-,26-/m1/s1 |
| InChIKey | KAJUQFNDHKZYAG-ABNLYDASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | PubMed (26860358) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS286) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricin 7-O-(6''-O-malonyl)-β-D-glucopyranoside (CHEBI:131768) has functional parent 3',5'-di-O-methyltricetin (CHEBI:59979) |
| tricin 7-O-(6''-O-malonyl)-β-D-glucopyranoside (CHEBI:131768) has role plant metabolite (CHEBI:76924) |
| tricin 7-O-(6''-O-malonyl)-β-D-glucopyranoside (CHEBI:131768) is a dihydroxyflavone (CHEBI:38686) |
| tricin 7-O-(6''-O-malonyl)-β-D-glucopyranoside (CHEBI:131768) is a dimethoxyflavone (CHEBI:23798) |
| tricin 7-O-(6''-O-malonyl)-β-D-glucopyranoside (CHEBI:131768) is a glycosyloxyflavone (CHEBI:50018) |
| tricin 7-O-(6''-O-malonyl)-β-D-glucopyranoside (CHEBI:131768) is a monosaccharide derivative (CHEBI:63367) |
| tricin 7-O-(6''-O-malonyl)-β-D-glucopyranoside (CHEBI:131768) is a polyphenol (CHEBI:26195) |
| tricin 7-O-(6''-O-malonyl)-β-D-glucopyranoside (CHEBI:131768) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxo-4H-1-benzopyran-7-yl 6-O-(carboxyacetyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 7-O-[(6''-O-malonyl)-β-D-glucopyranosyl]tricin | ChEBI |
| tricin 7-(6-malonylglucoside) | ChEBI |
| tricin 7-O-(6''-O-malonyl)-β-D-glucoside | ChEBI |
| 7-O-[(6''-O-malonyl)-β-D-glucosyl]tricin | ChEBI |
| Citations |
|---|