EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7O7P |
| Net Charge | -2 |
| Average Mass | 198.067 |
| Monoisotopic Mass | 197.99404 |
| SMILES | O=C(COP(=O)([O-])[O-])[C@H](O)CO |
| InChI | InChI=1S/C4H9O7P/c5-1-3(6)4(7)2-11-12(8,9)10/h3,5-6H,1-2H2,(H2,8,9,10)/p-2/t3-/m1/s1 |
| InChIKey | TZCZUVPSFJZERP-GSVOUGTGSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythrulose 1-phosphate(2−) (CHEBI:131767) is a organophosphate oxoanion (CHEBI:58945) |
| D-erythrulose 1-phosphate(2−) (CHEBI:131767) is conjugate base of D-erythrulose 1-phosphate (CHEBI:48262) |
| D-erythrulose 1-phosphate(2−) (CHEBI:131767) is enantiomer of L-erythrulose 1-phosphate(2−) (CHEBI:58002) |
| Incoming Relation(s) |
| D-erythrulose 1-phosphate (CHEBI:48262) is conjugate acid of D-erythrulose 1-phosphate(2−) (CHEBI:131767) |
| L-erythrulose 1-phosphate(2−) (CHEBI:58002) is enantiomer of D-erythrulose 1-phosphate(2−) (CHEBI:131767) |
| IUPAC Name |
|---|
| (3R)-3,4-dihydroxy-2-oxobutyl phosphate |
| UniProt Name | Source |
|---|---|
| D-erythrulose 1-phosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19135 | MetaCyc |
| Citations |
|---|