EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N3O12P2 |
| Net Charge | 0 |
| Average Mass | 431.187 |
| Monoisotopic Mass | 431.01310 |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)C(=O)O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C10H15N3O12P2/c11-5-1-2-13(9(16)12-5)8-7(15)6(14)4(24-8)3-23-27(21,22)25-26(19,20)10(17)18/h1-2,4,6-8,14-15H,3H2,(H,17,18)(H,19,20)(H,21,22)(H2,11,12,16)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | UKMKGKZFTWPAOJ-XVFCMESISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces hygroscopicus (ncbitaxon:1912) | - | PubMed (17632514) | Strain: ATCC 21705 |
| Streptomyces viridochromogenes DSM 40736 (ncbitaxon:591159) | - | PubMed (17632514) | Strain: DSM 40736 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CMP-5'-phosphonoformic acid (CHEBI:131759) has functional parent cytidine 5'-monophosphate (CHEBI:17361) |
| CMP-5'-phosphonoformic acid (CHEBI:131759) has functional parent phosphonoformic acid (CHEBI:127780) |
| CMP-5'-phosphonoformic acid (CHEBI:131759) has role bacterial metabolite (CHEBI:76969) |
| CMP-5'-phosphonoformic acid (CHEBI:131759) is a cytidine 5'-phosphate (CHEBI:23521) |
| CMP-5'-phosphonoformic acid (CHEBI:131759) is a monocarboxylic acid (CHEBI:25384) |
| CMP-5'-phosphonoformic acid (CHEBI:131759) is conjugate acid of CMP-5'-phosphonoformate(3−) (CHEBI:91255) |
| Incoming Relation(s) |
| CMP-5'-phosphonoformate(3−) (CHEBI:91255) is conjugate base of CMP-5'-phosphonoformic acid (CHEBI:131759) |
| IUPAC Name |
|---|
| 5'-O-[{[carboxy(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl]cytidine |
| Synonym | Source |
|---|---|
| Phosphonoformyl-CMP | KEGG COMPOUND |
| Citations |
|---|