EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8N2OS |
| Net Charge | 0 |
| Average Mass | 228.276 |
| Monoisotopic Mass | 228.03573 |
| SMILES | c1ccc(-c2noc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C12H8N2OS/c1-2-5-9(6-3-1)11-13-12(15-14-11)10-7-4-8-16-10/h1-8H |
| InChIKey | IHNSIFFSNUQGQN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tioxazafen (CHEBI:131756) has role agrochemical (CHEBI:33286) |
| tioxazafen (CHEBI:131756) has role nematicide (CHEBI:25491) |
| tioxazafen (CHEBI:131756) is a 1,2,4-oxadiazole (CHEBI:46809) |
| tioxazafen (CHEBI:131756) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 3-phenyl-5-(2-thienyl)-1,2,4-oxadiazole |
| Synonyms | Source |
|---|---|
| 3-phenyl-5-(thiophen-2-yl)-1,2,4-oxadiazole | Alan Wood's Pesticides |
| MON-102100 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2665 | PPDB |
| tioxazafen | Alan Wood's Pesticides |
| WO200828903 | Patent |
| WO20148257 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11829832 | Reaxys |
| CAS:330459-31-9 | ChemIDplus |
| Citations |
|---|