EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H31NO3 |
| Net Charge | 0 |
| Average Mass | 261.406 |
| Monoisotopic Mass | 261.23039 |
| SMILES | CCCCCCCCCCC(O)C(O)C(N)CO |
| InChI | InChI=1S/C14H31NO3/c1-2-3-4-5-6-7-8-9-10-13(17)14(18)12(15)11-16/h12-14,16-18H,2-11,15H2,1H3 |
| InChIKey | QDBLJDVWLXPWOQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | PubMed (26860358) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS286) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-1,3,4-tetradecanetriol (CHEBI:131750) has parent hydride tetradecane (CHEBI:41253) |
| 2-amino-1,3,4-tetradecanetriol (CHEBI:131750) has role plant metabolite (CHEBI:76924) |
| 2-amino-1,3,4-tetradecanetriol (CHEBI:131750) is a amino alcohol (CHEBI:22478) |
| 2-amino-1,3,4-tetradecanetriol (CHEBI:131750) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 2-aminotetradecane-1,3,4-triol |
| Citations |
|---|