EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H43NO4 |
| Net Charge | 0 |
| Average Mass | 361.567 |
| Monoisotopic Mass | 361.31921 |
| SMILES | CCCCCCCCCCCCCCCC(O)C(O)C(O)C(N)CO |
| InChI | InChI=1S/C20H43NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(23)20(25)19(24)17(21)16-22/h17-20,22-25H,2-16,21H2,1H3 |
| InChIKey | ILMFJEORWZZXPC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | PubMed (26860358) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS286) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-1,3,4,5-icosanetetrol (CHEBI:131749) has parent hydride icosane (CHEBI:43619) |
| 2-amino-1,3,4,5-icosanetetrol (CHEBI:131749) has role plant metabolite (CHEBI:76924) |
| 2-amino-1,3,4,5-icosanetetrol (CHEBI:131749) is a amino alcohol (CHEBI:22478) |
| 2-amino-1,3,4,5-icosanetetrol (CHEBI:131749) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| 2-aminoicosane-1,3,4,5-tetrol |
| Synonyms | Source |
|---|---|
| 2-amino-1,3,4,5-eicosanetetrol | ChEBI |
| 2-aminoeicosane-1,3,4,5-tetrol | ChEBI |
| Citations |
|---|