EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H44NO7P |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 477.286 |
| Monoisotopic Mass (excl. R groups) | 477.28554 |
| SMILES | *C(=O)O[C@H](CO)COP(=O)(O)OCCN |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS287) | ||
| seed (BTO:0001226) | PubMed (26860358) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysophosphatidylethanolamine (0:0/18:2) (CHEBI:131745) has role plant metabolite (CHEBI:76924) |
| lysophosphatidylethanolamine (0:0/18:2) (CHEBI:131745) is a 2-acyl-sn-glycero-3-phosphoethanolamine (CHEBI:28936) |
| lysophosphatidylethanolamine (0:0/18:2) (CHEBI:131745) is a lysophosphatidylethanolamine 18:2 (CHEBI:91296) |
| Incoming Relation(s) |
| 2-linoleoyl-sn-glycero-3-phosphoethanolamine (CHEBI:76233) is a lysophosphatidylethanolamine (0:0/18:2) (CHEBI:131745) |
| Synonyms | Source |
|---|---|
| LPE(0:0/18:2) | ChEBI |
| PE(0:0/18:2) | ChEBI |
| Citations |
|---|