EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18Cl2N2O5S |
| Net Charge | 0 |
| Average Mass | 433.313 |
| Monoisotopic Mass | 432.03135 |
| SMILES | [H][C@]12SC(C)(C)[C@]([H])(C(=O)O)N1C(=O)[C@@]2([H])NC(=O)C(OC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O5S/c1-17(2)12(16(24)25)21-14(23)10(15(21)27-17)20-13(22)11(26-3)7-4-5-8(18)9(19)6-7/h4-6,10-12,15H,1-3H3,(H,20,22)(H,24,25)/t10-,11?,12+,15-/m1/s1 |
| InChIKey | JKXQBIZCQJLVOS-GSNLGQFWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clometocillin (CHEBI:131732) has role antibacterial drug (CHEBI:36047) |
| clometocillin (CHEBI:131732) is a dichlorobenzene (CHEBI:23697) |
| clometocillin (CHEBI:131732) is a penicillin (CHEBI:17334) |
| clometocillin (CHEBI:131732) is a semisynthetic derivative (CHEBI:72588) |
| IUPAC Name |
|---|
| (2S,5R,6R)-6-[2-(3,4-dichlorophenyl)(methoxy)acetamido]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| INNs | Source |
|---|---|
| clometocilina | WHO MedNet |
| clometocillin | WHO MedNet |
| clométocilline | WHO MedNet |
| clometocillinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3,4-dichloro-α-methoxybenzylpenicillin | ChemIDplus |
| 6-(α-methoxy-3,4-dichlorophenylacetamido)penicillanic acid | ChEBI |
| clometacillin | ChemIDplus |
| clomethacillin | ChEBI |
| penicillin 356 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 699 | DrugCentral |
| Clometocillin | Wikipedia |
| D07236 | KEGG DRUG |
| US3007920 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13779003 | Reaxys |
| CAS:1926-49-4 | KEGG DRUG |
| CAS:1926-49-4 | ChemIDplus |
| Citations |
|---|