EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15Cl2N5O5S3 |
| Net Charge | 0 |
| Average Mass | 548.455 |
| Monoisotopic Mass | 546.96124 |
| SMILES | [H][C@]12SCC(CSc3nnc(C)s3)=C(C(=O)O)N1C(=O)[C@@]2([H])NC(=O)Cn1cc(Cl)c(=O)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N5O5S3/c1-7-22-23-18(33-7)32-6-8-5-31-16-12(15(28)25(16)13(8)17(29)30)21-11(26)4-24-2-9(19)14(27)10(20)3-24/h2-3,12,16H,4-6H2,1H3,(H,21,26)(H,29,30)/t12-,16-/m1/s1 |
| InChIKey | VTLCNEGVSVJLDN-MLGOLLRUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefazedone (CHEBI:131731) has role antibacterial drug (CHEBI:36047) |
| cefazedone (CHEBI:131731) is a 4-pyridones (CHEBI:20485) |
| cefazedone (CHEBI:131731) is a carboxylic acid (CHEBI:33575) |
| cefazedone (CHEBI:131731) is a cephalosporin (CHEBI:23066) |
| cefazedone (CHEBI:131731) is a semisynthetic derivative (CHEBI:72588) |
| cefazedone (CHEBI:131731) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 7-{[3,5-dichloro-4-oxopyridin-1(4H)-yl]acetamido}-3-{[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl}-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefazedone | WHO MedNet |
| cefazedonum | WHO MedNet |
| cefazedona | WHO MedNet |
| céfazédone | WHO MedNet |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-[2-(3,5-dichloro-4-oxopyridin-1(4H)-yl)acetamido]-3-{[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| EMD-30087 | ChEBI |
| Brand Names | Source |
|---|---|
| Refosporen | ChEBI |
| Refosporene | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5399221 | Reaxys |
| CAS:56187-47-4 | KEGG DRUG |
| CAS:56187-47-4 | ChemIDplus |
| Citations |
|---|