EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N6O5S2 |
| Net Charge | 0 |
| Average Mass | 462.513 |
| Monoisotopic Mass | 462.07801 |
| SMILES | [H][C@]12SCC(CSc3cnnn3)=C(C(=O)O)N1C(=O)[C@@]2([H])NC(=O)[C@H](N)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H18N6O5S2/c19-12(8-1-3-10(25)4-2-8)15(26)21-13-16(27)24-14(18(28)29)9(7-31-17(13)24)6-30-11-5-20-23-22-11/h1-5,12-13,17,25H,6-7,19H2,(H,21,26)(H,28,29)(H,20,22,23)/t12-,13-,17-/m1/s1 |
| InChIKey | UOCJDOLVGGIYIQ-PBFPGSCMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.7.11.20 (elongation factor 2 kinase) inhibitor Any EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of elongation factor 2 kinase (EC 2.7.11.20). antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefatrizine (CHEBI:131730) has role antibacterial drug (CHEBI:36047) |
| cefatrizine (CHEBI:131730) has role EC 2.7.11.20 (elongation factor 2 kinase) inhibitor (CHEBI:131734) |
| cefatrizine (CHEBI:131730) is a amino acid amide (CHEBI:22475) |
| cefatrizine (CHEBI:131730) is a carboxylic acid (CHEBI:33575) |
| cefatrizine (CHEBI:131730) is a cephalosporin (CHEBI:23066) |
| cefatrizine (CHEBI:131730) is a phenols (CHEBI:33853) |
| cefatrizine (CHEBI:131730) is a semisynthetic derivative (CHEBI:72588) |
| cefatrizine (CHEBI:131730) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| (6R,7R)-7-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-8-oxo-3-[(1H-1,2,3-triazol-4-ylsulfanyl)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| INNs | Source |
|---|---|
| cefatrizine | WHO MedNet |
| cefatrizina | WHO MedNet |
| céfatrizine | WHO MedNet |
| cefatrizinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (7R)-7-(α-D-4-hydroxyphenylglycylamino)-3-(1H-1,2,3-triazol-4-ylthiomethyl)-3-cephem-4-carboxylic acid | ChEBI |
| SKF 60771 | ChemIDplus |
| antibiotic BL-S 640 | ChemIDplus |
| BLS 640 | ChemIDplus |
| BL-S640 | ChemIDplus |
| BL-S 640 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8172545 | Reaxys |
| CAS:51627-14-6 | KEGG DRUG |
| CAS:51627-14-6 | ChemIDplus |
| Citations |
|---|