EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N5O6S2 |
| Net Charge | 0 |
| Average Mass | 453.502 |
| Monoisotopic Mass | 453.07768 |
| SMILES | [H][C@]12SCC(COC(N)=O)=C(C(=O)O)N1C(=O)[C@@]2([H])NC(=O)/C(=C\CC)c1csc(N)n1 |
| InChI | InChI=1S/C17H19N5O6S2/c1-2-3-8(9-6-30-16(18)20-9)12(23)21-10-13(24)22-11(15(25)26)7(4-28-17(19)27)5-29-14(10)22/h3,6,10,14H,2,4-5H2,1H3,(H2,18,20)(H2,19,27)(H,21,23)(H,25,26)/b8-3-/t10-,14-/m1/s1 |
| InChIKey | HJJRIJDTIPFROI-NVKITGPLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefcapene (CHEBI:131729) has role antibacterial drug (CHEBI:36047) |
| cefcapene (CHEBI:131729) is a 1,3-thiazoles (CHEBI:38418) |
| cefcapene (CHEBI:131729) is a carbamate ester (CHEBI:23003) |
| cefcapene (CHEBI:131729) is a carboxylic acid (CHEBI:33575) |
| cefcapene (CHEBI:131729) is a cephalosporin (CHEBI:23066) |
| cefcapene (CHEBI:131729) is a enamide (CHEBI:51751) |
| cefcapene (CHEBI:131729) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)pent-2-enoyl]amino}-3-[(carbamoyloxy)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| INNs | Source |
|---|---|
| cefcapene | WHO MedNet |
| cefcapène | WHO MedNet |
| cefcapeno | WHO MedNet |
| cefcapenum | WHO MedNet |
| Synonym | Source |
|---|---|
| CFPN | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6945919 | Reaxys |
| CAS:135889-00-8 | KEGG DRUG |
| CAS:135889-00-8 | ChemIDplus |
| Citations |
|---|