EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N4O2S |
| Net Charge | 0 |
| Average Mass | 264.310 |
| Monoisotopic Mass | 264.06810 |
| SMILES | Cc1cnc(NS(=O)(=O)c2ccc(N)cc2)nc1 |
| InChI | InChI=1S/C11H12N4O2S/c1-8-6-13-11(14-7-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey | DZQVFHSCSRACSX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfaperin (CHEBI:131722) has role antibacterial drug (CHEBI:36047) |
| sulfaperin (CHEBI:131722) is a pyrimidines (CHEBI:39447) |
| sulfaperin (CHEBI:131722) is a substituted aniline (CHEBI:48975) |
| sulfaperin (CHEBI:131722) is a sulfonamide antibiotic (CHEBI:87228) |
| IUPAC Name |
|---|
| 4-amino-N-(5-methylpyrimidin-2-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfaperin | WHO MedNet |
| sulfapérin | WHO MedNet |
| sulfaperina | WHO MedNet |
| sulfaperinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(p-aminobenzenesulfonamido)-5-methylpyrimidine | ChemIDplus |
| 2-(sulfanilamido)-5-methylpyrimidine | ChemIDplus |
| 4-amino-N-(5-methyl-2-pyrimidinyl)benzenesulfonamide | ChemIDplus |
| 5-methylsulfadiazine | ChemIDplus |
| N1-(5-methyl-2-pyrimidinyl)sulfanilamide | ChemIDplus |
| isosulfamerazine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Anastaf | ChemIDplus |
| Archisulfa | ChemIDplus |
| Avissul | ChemIDplus |
| Chemiopen | ChemIDplus |
| Demosulfan | ChemIDplus |
| Durisan | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2522 | DrugCentral |
| D07240 | KEGG DRUG |
| Sulfaperin | Wikipedia |
| US2407966 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:249118 | Reaxys |
| CAS:599-88-2 | ChemIDplus |
| CAS:599-88-2 | KEGG DRUG |
| Citations |
|---|