EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H66FNO13 |
| Net Charge | 0 |
| Average Mass | 751.927 |
| Monoisotopic Mass | 751.45182 |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@](C)(O)C[C@](C)(F)C(=O)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C37H66FNO13/c1-14-24-37(10,46)29(42)21(5)28(41)34(7,38)17-35(8,45)31(52-33-26(40)23(39(11)12)15-18(2)48-33)19(3)27(20(4)32(44)50-24)51-25-16-36(9,47-13)30(43)22(6)49-25/h18-27,29-31,33,40,42-43,45-46H,14-17H2,1-13H3/t18-,19+,20-,21+,22+,23+,24-,25+,26-,27+,29-,30+,31-,33+,34+,35-,36-,37-/m1/s1 |
| InChIKey | XOEUHCONYHZURQ-HNUBZJOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flurithromycin (CHEBI:131719) has functional parent erythromycin A (CHEBI:42355) |
| flurithromycin (CHEBI:131719) has role antibacterial drug (CHEBI:36047) |
| flurithromycin (CHEBI:131719) is a cyclic ketone (CHEBI:3992) |
| flurithromycin (CHEBI:131719) is a erythromycin derivative (CHEBI:48924) |
| flurithromycin (CHEBI:131719) is a organofluorine compound (CHEBI:37143) |
| flurithromycin (CHEBI:131719) is a semisynthetic derivative (CHEBI:72588) |
| IUPAC Name |
|---|
| (3R,4S,5S,6R,7R,9S,11R,12R,13S,14R)-6-{[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-14-ethyl-9-fluoro-7,12,13-trihydroxy-4-{[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyltetrahydro-2H-pyran-2-yl]oxy}-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione |
| INNs | Source |
|---|---|
| flurithromycin | WHO MedNet |
| fluritromicina | WHO MedNet |
| flurithromycinum | WHO MedNet |
| flurithromycine | WHO MedNet |
| Synonyms | Source |
|---|---|
| antibiotic P 80206 | ChemIDplus |
| P-0501A | ChemIDplus |
| P 80206 | ChemIDplus |
| Cl-932 | ChemIDplus |
| 8-fluoroerythromycin | ChemIDplus |
| (8S)-8-fluoroerythromycin A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D07242 | KEGG DRUG |
| Flurithromycin | Wikipedia |
| 1221 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6950255 | Reaxys |
| CAS:82664-20-8 | KEGG DRUG |
| CAS:82664-20-8 | ChemIDplus |
| Citations |
|---|