EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20F2N2O4 |
| Net Charge | 0 |
| Average Mass | 426.419 |
| Monoisotopic Mass | 426.13911 |
| SMILES | C[C@H]1NCc2cc(-c3ccc4c(=O)c(C(=O)O)cn(C5CC5)c4c3OC(F)F)ccc21 |
| InChI | InChI=1S/C23H20F2N2O4/c1-11-15-5-2-12(8-13(15)9-26-11)16-6-7-17-19(21(16)31-23(24)25)27(14-3-4-14)10-18(20(17)28)22(29)30/h2,5-8,10-11,14,23,26H,3-4,9H2,1H3,(H,29,30)/t11-/m1/s1 |
| InChIKey | NJDRXTDGYFKORP-LLVKDONJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| garenoxacin (CHEBI:131716) has role antibacterial drug (CHEBI:36047) |
| garenoxacin (CHEBI:131716) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| garenoxacin (CHEBI:131716) is a aromatic ether (CHEBI:35618) |
| garenoxacin (CHEBI:131716) is a cyclopropanes (CHEBI:51454) |
| garenoxacin (CHEBI:131716) is a isoindoles (CHEBI:24897) |
| garenoxacin (CHEBI:131716) is a organofluorine compound (CHEBI:37143) |
| garenoxacin (CHEBI:131716) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| garenoxacin (CHEBI:131716) is a quinolone antibiotic (CHEBI:86324) |
| INNs | Source |
|---|---|
| garenoxacin | WHO MedNet |
| garénoxacine | WHO MedNet |
| garenoxacino | WHO MedNet |
| garenoxacinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BMS 284756 | ChEBI |
| BMS-284756 | ChEBI |
| BMS284756 | ChEBI |
| T 3811 | ChemIDplus |
| T-3811 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4053 | DrugCentral |
| Garenoxacin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8878492 | Reaxys |
| CAS:194804-75-6 | ChemIDplus |
| Citations |
|---|