EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14N2O3 |
| Net Charge | 0 |
| Average Mass | 294.310 |
| Monoisotopic Mass | 294.10044 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2ccc(-c3ccncc3)cc21 |
| InChI | InChI=1S/C17H14N2O3/c1-2-19-10-14(17(21)22)16(20)13-4-3-12(9-15(13)19)11-5-7-18-8-6-11/h3-10H,2H2,1H3,(H,21,22) |
| InChIKey | XBPZXDSZHPDXQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosoxacin (CHEBI:131715) has role antibacterial drug (CHEBI:36047) |
| rosoxacin (CHEBI:131715) has role antiinfective agent (CHEBI:35441) |
| rosoxacin (CHEBI:131715) is a pyridines (CHEBI:26421) |
| rosoxacin (CHEBI:131715) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| rosoxacin (CHEBI:131715) is a quinolone antibiotic (CHEBI:86324) |
| IUPAC Name |
|---|
| 1-ethyl-4-oxo-7-(pyridin-4-yl)-1,4-dihydroquinoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| rosoxacin | WHO MedNet |
| rosoxacina | WHO MedNet |
| rosoxacine | WHO MedNet |
| rosoxacinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-ethyl-1,4-dihydro-4-oxo-7-(4-pyridyl)-3-quinolinecarboxylic acid | ChemIDplus |
| Win 35,213 | ChemIDplus |
| Win 35213 | ChEBI |
| Win-35,213 | ChEBI |
| Brand Names | Source |
|---|---|
| Eradacil | ChemIDplus |
| Roxadyl | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:758231 | Reaxys |
| CAS:40034-42-2 | ChemIDplus |
| CAS:40034-42-2 | KEGG DRUG |
| Citations |
|---|