EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131714 - furagin
| Formula | C10H8N4O5 |
| Net Charge | 0 |
| Average Mass | 264.197 |
| Monoisotopic Mass | 264.04947 |
| SMILES | O=C1CN(N=CC=Cc2ccc([N+](=O)[O-])o2)C(=O)N1 |
| InChI | InChI=1S/C10H8N4O5/c15-8-6-13(10(16)12-8)11-5-1-2-7-3-4-9(19-7)14(17)18/h1-5H,6H2,(H,12,15,16) |
| InChIKey | DECBQELQORZLLP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| furagin (CHEBI:131714) has functional parent semicarbazide (CHEBI:28306) |
| furagin (CHEBI:131714) has role antibacterial drug (CHEBI:36047) |
| furagin (CHEBI:131714) has role antiinfective agent (CHEBI:35441) |
| furagin (CHEBI:131714) is a imidazolidine-2,4-dione (CHEBI:24628) |
| furagin (CHEBI:131714) is a nitrofuran antibiotic (CHEBI:87230) |
| furagin (CHEBI:131714) is a organonitrogen heterocyclic antibiotic (CHEBI:25558) |
| furagin (CHEBI:131714) is a organooxygen heterocyclic antibiotic (CHEBI:25807) |
| IUPAC Name |
|---|
| 1-{[3-(5-nitro-2-furyl)prop-2-en-1-ylidene]amino}imidazolidine-2,4-dione |
| Synonyms | Source |
|---|---|
| NF 416 | ChemIDplus |
| NF-416 | IUBMB |
| 1-((3-(5-nitro-2-furyl)allylidene)amino)-hydantoin | ChemIDplus |
| NF416 | IUBMB |
| furazidine | ChemIDplus |
| furazidin | ChemIDplus |
| Brand Names | Source |
|---|---|
| Furagin | KEGG DRUG |
| Akritoin | ChemIDplus |
| Citations |
|---|