EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O |
| Net Charge | 0 |
| Average Mass | 258.405 |
| Monoisotopic Mass | 258.19837 |
| SMILES | [H][C@@]12CC[C@@](C)([C@H](c3cc(C)c(C)cc3O)C1)C2(C)C |
| InChI | InChI=1S/C18H26O/c1-11-8-14(16(19)9-12(11)2)15-10-13-6-7-18(15,5)17(13,3)4/h8-9,13,15,19H,6-7,10H2,1-5H3/t13-,15+,18+/m1/s1 |
| InChIKey | RNRHMQWZFJXKLZ-XUWXXGDYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xibornol (CHEBI:131713) has parent hydride bornane (CHEBI:35783) |
| xibornol (CHEBI:131713) has role antibacterial drug (CHEBI:36047) |
| xibornol (CHEBI:131713) is a bridged compound (CHEBI:35990) |
| xibornol (CHEBI:131713) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4,5-dimethyl-2-[(1S,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl]phenol |
| INNs | Source |
|---|---|
| xibornol | ChemIDplus |
| xibornolum | ChemIDplus |
| xibornol | ChEBI |
| xibornol | ChEBI |
| Synonyms | Source |
|---|---|
| 6-Isobornyl-3,4-xylenol | ChemIDplus |
| (exo)-4,5-Dimethyl-2-(1,7,7-trimethylbicyclo(2.2.1)hept-2-yl)phenol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2561603 | Reaxys |
| CAS:13741-18-9 | KEGG DRUG |
| CAS:13741-18-9 | ChemIDplus |
| Citations |
|---|