EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H41NO4 |
| Net Charge | 0 |
| Average Mass | 383.573 |
| Monoisotopic Mass | 383.30356 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C22H41NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(25)23-21(19(2)24)22(26)27/h10-11,19,21,24H,3-9,12-18H2,1-2H3,(H,23,25)(H,26,27)/b11-10-/t19-,21+/m1/s1 |
| InChIKey | NEMXEZCVUJCXDQ-PCXBEVNGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS334) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oleoylthreonine (CHEBI:131695) has functional parent oleic acid (CHEBI:16196) |
| N-oleoylthreonine (CHEBI:131695) has role mouse metabolite (CHEBI:75771) |
| N-oleoylthreonine (CHEBI:131695) is a N-acyl-L-amino acid (CHEBI:21644) |
| N-oleoylthreonine (CHEBI:131695) is a L-threonine derivative (CHEBI:84189) |
| IUPAC Name |
|---|
| N-[(9Z)-octadec-9-enoyl]-L-threonine |
| Synonyms | Source |
|---|---|
| N-oleoyl-L-threonine | ChEBI |
| N-(9Z-octadecenoyl)-threonine | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA08020108 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20745804 | Reaxys |