EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | CCCCCC=CCC=CCC=CCC#CCCCC(=O)O |
| InChI | InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13H,2-5,8,11,14,17-19H2,1H3,(H,21,22) |
| InChIKey | GIOQWSLKUVKKAO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS334) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8,11,14-icosatrien-5-ynoic acid (CHEBI:131667) has role mouse metabolite (CHEBI:75771) |
| 8,11,14-icosatrien-5-ynoic acid (CHEBI:131667) is a acetylenic fatty acid (CHEBI:25380) |
| 8,11,14-icosatrien-5-ynoic acid (CHEBI:131667) is a long-chain fatty acid (CHEBI:15904) |
| 8,11,14-icosatrien-5-ynoic acid (CHEBI:131667) is a trienoic fatty acid (CHEBI:73155) |
| IUPAC Name |
|---|
| icosa-8,11,14-trien-5-ynoic acid |
| Synonyms | Source |
|---|---|
| 8,11,14-eicosatrien-5-ynoic acid | ChEBI |
| eicosa-8,11,14-trien-5-ynoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1712 | ChemSpider |