EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O4 |
| Net Charge | 0 |
| Average Mass | 218.253 |
| Monoisotopic Mass | 218.12666 |
| SMILES | N[C@@H](CCCCNCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H18N2O4/c10-7(9(14)15)3-1-2-5-11-6-4-8(12)13/h7,11H,1-6,10H2,(H,12,13)(H,14,15)/t7-/m0/s1 |
| InChIKey | SPBWCBIQZFYDOE-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-(2-carboxyethyl)-L-lysine (CHEBI:131623) is a N6-(2-carboxyethyl)lysine (CHEBI:61063) |
| Incoming Relation(s) |
| N6-(2-carboxyethyl)-L-lysine residue (CHEBI:131624) is substituent group from N6-(2-carboxyethyl)-L-lysine (CHEBI:131623) |
| IUPAC Name |
|---|
| N6-(2-carboxyethyl)-L-lysine |
| Synonyms | Source |
|---|---|
| Nε-(carboxyethyl)-L-lysine | ChEBI |
| Nε-(2-carboxyethyl)-L-lysine | ChEBI |
| Nε-carboxyethyllysine | ChEBI |
| Nε-carboxyethyl-L-lysine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2723741 | Reaxys |