EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18F3N3O3 |
| Net Charge | 0 |
| Average Mass | 429.398 |
| Monoisotopic Mass | 429.13003 |
| SMILES | C[C@H]1[C@@H](c2cccc(C(F)(F)F)c2)OC(=O)N1C(=O)NCc1cncc2ccccc12 |
| InChI | InChI=1S/C22H18F3N3O3/c1-13-19(14-6-4-7-17(9-14)22(23,24)25)31-21(30)28(13)20(29)27-12-16-11-26-10-15-5-2-3-8-18(15)16/h2-11,13,19H,12H2,1H3,(H,27,29)/t13-,19-/m0/s1 |
| InChIKey | HDCFKIPEUIIJHB-DJJJIMSYSA-N |
| Roles Classification |
|---|
| Biological Role: | teichoic acid biosynthesis inhibitor Any compound that inhibits the biosynthesis of teichoic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tarocin A2 (CHEBI:131615) has functional parent oxazolidin-2-one (CHEBI:1237) |
| tarocin A2 (CHEBI:131615) has role teichoic acid biosynthesis inhibitor (CHEBI:131611) |
| tarocin A2 (CHEBI:131615) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| tarocin A2 (CHEBI:131615) is a N-acylurea (CHEBI:74266) |
| tarocin A2 (CHEBI:131615) is a carbamate ester (CHEBI:23003) |
| tarocin A2 (CHEBI:131615) is a dicarboximide (CHEBI:35356) |
| tarocin A2 (CHEBI:131615) is a isoquinolines (CHEBI:24922) |
| tarocin A2 (CHEBI:131615) is a oxazolidinone (CHEBI:55374) |
| IUPAC Name |
|---|
| (4S,5R)-N-[(isoquinolin-4-yl)methyl]-4-methyl-2-oxo-5-[3-(trifluoromethyl)phenyl]-1,3-oxazolidine-3-carboxamide |
| Citations |
|---|