EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H17F6NO3 |
| Net Charge | 0 |
| Average Mass | 481.392 |
| Monoisotopic Mass | 481.11126 |
| SMILES | C[C@H]1[C@@H](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)OC(=O)N1C(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C24H17F6NO3/c1-13-21(16-9-17(23(25,26)27)12-18(10-16)24(28,29)30)34-22(33)31(13)20(32)11-15-7-4-6-14-5-2-3-8-19(14)15/h2-10,12-13,21H,11H2,1H3/t13-,21-/m0/s1 |
| InChIKey | GBVCJLDLMGPDCL-ZSEKCTLFSA-N |
| Roles Classification |
|---|
| Biological Role: | teichoic acid biosynthesis inhibitor Any compound that inhibits the biosynthesis of teichoic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tarocin A (CHEBI:131612) has functional parent oxazolidin-2-one (CHEBI:1237) |
| tarocin A (CHEBI:131612) has role teichoic acid biosynthesis inhibitor (CHEBI:131611) |
| tarocin A (CHEBI:131612) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| tarocin A (CHEBI:131612) is a carbamate ester (CHEBI:23003) |
| tarocin A (CHEBI:131612) is a dicarboximide (CHEBI:35356) |
| tarocin A (CHEBI:131612) is a naphthalenes (CHEBI:25477) |
| tarocin A (CHEBI:131612) is a oxazolidinone (CHEBI:55374) |
| IUPAC Name |
|---|
| (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-[(naphthalen-1-yl)acetyl]-1,3-oxazolidin-2-one |
| Citations |
|---|