EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6N2O4S2 |
| Net Charge | 0 |
| Average Mass | 282.302 |
| Monoisotopic Mass | 281.97690 |
| SMILES | Cn1c(=O)c2sc3c(=O)n(C)c(=O)c3sc2c1=O |
| InChI | InChI=1S/C10H6N2O4S2/c1-11-7(13)3-4(8(11)14)18-6-5(17-3)9(15)12(2)10(6)16/h1-2H3 |
| InChIKey | FPKXBFWMIYHCID-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipymetitrone (CHEBI:131600) has functional parent maleimide (CHEBI:16072) |
| dipymetitrone (CHEBI:131600) has role antifungal agrochemical (CHEBI:86328) |
| dipymetitrone (CHEBI:131600) is a dicarboximide fungicide (CHEBI:87195) |
| dipymetitrone (CHEBI:131600) is a organic heterotricyclic compound (CHEBI:26979) |
| dipymetitrone (CHEBI:131600) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| dipymetitrone (CHEBI:131600) is a organosulfur heterocyclic compound (CHEBI:38106) |
| dipymetitrone (CHEBI:131600) is a organosulfur pesticide (CHEBI:39189) |
| IUPAC Name |
|---|
| 2,6-dimethyl-1H,5H-[1,4]dithiino[2,3-c:5,6-c']dipyrrole-1,3,5,7(2H,6H)-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 3088 | PPDB |
| dipymetitrone | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1085578 | Reaxys |