EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131599 - dicloromezotiaz
| Formula | C19H12Cl3N3O2S |
| Net Charge | 0 |
| Average Mass | 452.750 |
| Monoisotopic Mass | 450.97158 |
| SMILES | Cc1cccn2c(=O)[c-](-c3cc(Cl)cc(Cl)c3)c(=O)[n+](Cc3cnc(Cl)s3)c12 |
| InChI | InChI=1S/C19H12Cl3N3O2S/c1-10-3-2-4-24-16(10)25(9-14-8-23-19(22)28-14)18(27)15(17(24)26)11-5-12(20)7-13(21)6-11/h2-8H,9H2,1H3 |
| InChIKey | PVDQXPBKBSCNJZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicloromezotiaz (CHEBI:131599) has role agrochemical (CHEBI:33286) |
| dicloromezotiaz (CHEBI:131599) is a 1,3-thiazoles (CHEBI:38418) |
| dicloromezotiaz (CHEBI:131599) is a dichlorobenzene (CHEBI:23697) |
| dicloromezotiaz (CHEBI:131599) is a iminium betaine (CHEBI:35285) |
| dicloromezotiaz (CHEBI:131599) is a organochlorine insecticide (CHEBI:25705) |
| dicloromezotiaz (CHEBI:131599) is a pyridopyrimidine (CHEBI:38932) |
| IUPAC Name |
|---|
| 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(3,5-dichlorophenyl)-9-methyl-2,4-dioxo-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-1-ium-3-ide |
| Synonym | Source |
|---|---|
| 1-[(2-chloro-5-thiazolyl)methyl]-3-(3,5-dichlorophenyl)-9-methyl-2,4-dioxo-2H-pyrido[1,2-a]pyrimidinium inner salt | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 3092 | PPDB |
| dicloromezotiaz | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:1263629-39-5 | ChemIDplus |
| Citations |
|---|