EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H14BrF11N2O2 |
| Net Charge | 0 |
| Average Mass | 663.281 |
| Monoisotopic Mass | 662.00630 |
| SMILES | CN(C(=O)c1ccccc1)c1cccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1F |
| InChI | InChI=1S/C25H14BrF11N2O2/c1-39(21(41)12-6-3-2-4-7-12)17-9-5-8-14(18(17)27)20(40)38-19-15(23(29,30)31)10-13(11-16(19)26)22(28,24(32,33)34)25(35,36)37/h2-11H,1H3,(H,38,40) |
| InChIKey | QSLZKWPYTWEWHC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| broflanilide (CHEBI:131598) has role agrochemical (CHEBI:33286) |
| broflanilide (CHEBI:131598) has role GABA antagonist (CHEBI:65259) |
| broflanilide (CHEBI:131598) has role insecticide (CHEBI:24852) |
| broflanilide (CHEBI:131598) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| broflanilide (CHEBI:131598) is a benzamides (CHEBI:22702) |
| broflanilide (CHEBI:131598) is a bromobenzenes (CHEBI:37149) |
| broflanilide (CHEBI:131598) is a monofluorobenzenes (CHEBI:83575) |
| broflanilide (CHEBI:131598) is a organofluorine insecticide (CHEBI:38804) |
| IUPAC Name |
|---|
| 3-[benzoyl(methyl)amino]-N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-2-fluorobenzamide |
| Synonyms | Source |
|---|---|
| N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-2-fluoro-3-(N-methylbenzamido)benzamide | Alan Wood's Pesticides |
| 6'-bromo-α,α,α,2-tetrafluoro-3-(N-methylbenzamido)-4'-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]benz-o-toluidide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| broflanilide | Alan Wood's Pesticides |
| 3091 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21373509 | Reaxys |
| Citations |
|---|