EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5ClF3NO2S2 |
| Net Charge | 0 |
| Average Mass | 291.703 |
| Monoisotopic Mass | 290.94023 |
| SMILES | O=S(=O)(CCC(F)=C(F)F)c1ncc(Cl)s1 |
| InChI | InChI=1S/C7H5ClF3NO2S2/c8-5-3-12-7(15-5)16(13,14)2-1-4(9)6(10)11/h3H,1-2H2 |
| InChIKey | XSNMWAPKHUGZGQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluensulfone (CHEBI:131597) has role agrochemical (CHEBI:33286) |
| fluensulfone (CHEBI:131597) has role nematicide (CHEBI:25491) |
| fluensulfone (CHEBI:131597) is a 1,3-thiazoles (CHEBI:38418) |
| fluensulfone (CHEBI:131597) is a olefinic compound (CHEBI:78840) |
| fluensulfone (CHEBI:131597) is a organochlorine pesticide (CHEBI:38656) |
| fluensulfone (CHEBI:131597) is a organofluorine pesticide (CHEBI:38805) |
| fluensulfone (CHEBI:131597) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 5-chloro-2-(3,4,4-trifluorobut-3-ene-1-sulfonyl)-1,3-thiazole |
| Synonyms | Source |
|---|---|
| 5-chloro-1,3-thiazol-2-yl 3,4,4-trifluorobut-3-en-1-yl sulfone | ChemIDplus |
| 5-chloro-2-(3,4,4-trifluorobut-3-en-1-ylsulfonyl)-1,3-thiazole | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2895 | PPDB |
| fluensulfone | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11323358 | Reaxys |
| CAS:318290-98-1 | ChemIDplus |
| Citations |
|---|