EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H36MgN4O3 |
| Net Charge | 0 |
| Average Mass | 585.003 |
| Monoisotopic Mass | 584.26378 |
| SMILES | C=Cc1c(C)c2[n]3c1=CC1=[N+]4C(=Cc5c(CC)c6c7[n]5[Mg-2]34[N+]3=C(C=2)[C@@H](C)[C@H](CCC(=O)O)C3=C7CC6=O)C(CCC)=C1C |
| InChI | InChI=1S/C35H38N4O3.Mg/c1-7-10-22-18(5)26-15-28-20(8-2)17(4)25(36-28)14-27-19(6)23(11-12-32(41)42)34(38-27)24-13-31(40)33-21(9-3)29(39-35(24)33)16-30(22)37-26;/h8,14-16,19,23H,2,7,9-13H2,1,3-6H3,(H3,36,37,38,39,40,41,42);/q;+2/p-2/t19-,23-;/m0./s1 |
| InChIKey | KEGFWQJFYCEKAJ-ZWHLOQRUSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlorobaculum tepidum (ncbitaxon:1097) | - | PubMed (17586634) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-ethyl-8-propyl-3-vinylbacteriochlorophyllide d (CHEBI:131587) has role bacterial metabolite (CHEBI:76969) |
| 12-ethyl-8-propyl-3-vinylbacteriochlorophyllide d (CHEBI:131587) is a chlorophyllide (CHEBI:38206) |
| 12-ethyl-8-propyl-3-vinylbacteriochlorophyllide d (CHEBI:131587) is a monocarboxylic acid (CHEBI:25384) |
| 12-ethyl-8-propyl-3-vinylbacteriochlorophyllide d (CHEBI:131587) is conjugate acid of 12-ethyl-8-propyl-3-vinylbacteriochlorophyllide d(1−) (CHEBI:90966) |
| Incoming Relation(s) |
| 12-ethyl-8-propyl-3-vinylbacteriochlorophyllide d(1−) (CHEBI:90966) is conjugate base of 12-ethyl-8-propyl-3-vinylbacteriochlorophyllide d (CHEBI:131587) |
| IUPAC Name |
|---|
| {3-[(3S,4S)-9-ethenyl-18-ethyl-4,8,13-trimethyl-20-oxo-14-propylphorbin-3-yl-κ4N23,N24,N25,N26]propanoato(2−)}magnesium |
| Manual Xrefs | Databases |
|---|---|
| CPD-18843 | MetaCyc |