EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N2O2.2HCl |
| Net Charge | 0 |
| Average Mass | 241.118 |
| Monoisotopic Mass | 240.04323 |
| SMILES | Cc1ncc(CO)c(CN)c1O.Cl.Cl |
| InChI | InChI=1S/C8H12N2O2.2ClH/c1-5-8(12)7(2-9)6(4-11)3-10-5;;/h3,11-12H,2,4,9H2,1H3;2*1H |
| InChIKey | HNWCOANXZNKMLR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) |
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Applications: | nephroprotective agent Any protective agent that is able to prevent damage to the kidney. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridoxamine dihydrochloride (CHEBI:131532) has part pyridoxamine(2+) (CHEBI:131533) |
| pyridoxamine dihydrochloride (CHEBI:131532) has role Escherichia coli metabolite (CHEBI:76971) |
| pyridoxamine dihydrochloride (CHEBI:131532) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| pyridoxamine dihydrochloride (CHEBI:131532) has role human metabolite (CHEBI:77746) |
| pyridoxamine dihydrochloride (CHEBI:131532) has role iron chelator (CHEBI:38157) |
| pyridoxamine dihydrochloride (CHEBI:131532) has role mouse metabolite (CHEBI:75771) |
| pyridoxamine dihydrochloride (CHEBI:131532) has role nephroprotective agent (CHEBI:76595) |
| pyridoxamine dihydrochloride (CHEBI:131532) has role plant metabolite (CHEBI:76924) |
| pyridoxamine dihydrochloride (CHEBI:131532) is a hydrochloride (CHEBI:36807) |
| pyridoxamine dihydrochloride (CHEBI:131532) is a vitamin B6 (CHEBI:27306) |
| IUPAC Names |
|---|
| 4-(aminomethyl)-5-(hydroxymethyl)-2-methylpyridin-3-ol dihydrochloride |
| 4-(azaniumylmethyl)-3-hydroxy-5-(hydroxymethyl)-2-methylpyridin-1-ium dichloride |
| Synonyms | Source |
|---|---|
| 2-Methyl-3-hydroxy-4-aminomethyl-5-hydroxymethylpyridene dihydrochloride | ChemIDplus |
| 4-(Aminomethyl)-5-hydroxy-6-methyl-3-pyridinemethanol dihydrochloride | ChemIDplus |
| pyridoxamine 2HCl | ChEBI |
| Pyridoxamine dichlorohydrate | ChemIDplus |
| Pyridoxylamine dihydrochloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Pyridoxamine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3632748 | Reaxys |
| CAS:524-36-7 | ChemIDplus |
| Citations |
|---|