EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131531 - pyridoxamine hydrochloride
| Formula | C8H12N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 204.657 |
| Monoisotopic Mass | 204.06656 |
| SMILES | Cc1ncc(CO)c(CN)c1O.Cl |
| InChI | InChI=1S/C8H12N2O2.ClH/c1-5-8(12)7(2-9)6(4-11)3-10-5;/h3,11-12H,2,4,9H2,1H3;1H |
| InChIKey | PFIPZKASKUWLHH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) |
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Applications: | nephroprotective agent Any protective agent that is able to prevent damage to the kidney. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridoxamine hydrochloride (CHEBI:131531) has part pyridoxaminium(1+) (CHEBI:57761) |
| pyridoxamine hydrochloride (CHEBI:131531) has role Escherichia coli metabolite (CHEBI:76971) |
| pyridoxamine hydrochloride (CHEBI:131531) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| pyridoxamine hydrochloride (CHEBI:131531) has role human metabolite (CHEBI:77746) |
| pyridoxamine hydrochloride (CHEBI:131531) has role iron chelator (CHEBI:38157) |
| pyridoxamine hydrochloride (CHEBI:131531) has role mouse metabolite (CHEBI:75771) |
| pyridoxamine hydrochloride (CHEBI:131531) has role nephroprotective agent (CHEBI:76595) |
| pyridoxamine hydrochloride (CHEBI:131531) has role plant metabolite (CHEBI:76924) |
| pyridoxamine hydrochloride (CHEBI:131531) is a hydrochloride (CHEBI:36807) |
| pyridoxamine hydrochloride (CHEBI:131531) is a vitamin B6 (CHEBI:27306) |
| IUPAC Names |
|---|
| [3-hydroxy-5-(hydroxymethyl)-2-methylpyridin-4-yl]methanaminium chloride |
| 4-(aminomethyl)-5-(hydroxymethyl)-2-methylpyridin-3-ol hydrochloride |
| Synonyms | Source |
|---|---|
| 4-(Aminomethyl)-5-hydroxy-6-methyl-3-pyridinemethanol hydrochloride | ChemIDplus |
| Pyridoxamine HCl | ChemIDplus |
| pyridoxamine monohydrochloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-22933 | MetaCyc |
| Pyridoxamine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3709145 | Reaxys |
| CAS:5103-96-8 | ChemIDplus |
| Citations |
|---|