EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO3.HCl |
| Net Charge | 0 |
| Average Mass | 203.625 |
| Monoisotopic Mass | 203.03492 |
| SMILES | Cl.[H]C(=O)c1c(CO)cnc(C)c1O |
| InChI | InChI=1S/C8H9NO3.ClH/c1-5-8(12)7(4-11)6(3-10)2-9-5;/h2,4,10,12H,3H2,1H3;1H |
| InChIKey | FCHXJFJNDJXENQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (NCBI:562) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridoxal hydrochloride (CHEBI:131529) has part pyridoxal(1+) (CHEBI:131530) |
| pyridoxal hydrochloride (CHEBI:131529) has role Escherichia coli metabolite (CHEBI:76971) |
| pyridoxal hydrochloride (CHEBI:131529) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| pyridoxal hydrochloride (CHEBI:131529) has role cofactor (CHEBI:23357) |
| pyridoxal hydrochloride (CHEBI:131529) has role human metabolite (CHEBI:77746) |
| pyridoxal hydrochloride (CHEBI:131529) has role mouse metabolite (CHEBI:75771) |
| pyridoxal hydrochloride (CHEBI:131529) is a hydrochloride (CHEBI:36807) |
| pyridoxal hydrochloride (CHEBI:131529) is a pyridinium salt (CHEBI:38188) |
| pyridoxal hydrochloride (CHEBI:131529) is a vitamin B6 (CHEBI:27306) |
| IUPAC Names |
|---|
| 3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carbaldehyde hydrochloride |
| 4-formyl-3-hydroxy-5-(hydroxymethyl)-2-methylpyridin-1-ium chloride |
| Synonyms | Source |
|---|---|
| 2-Methyl-3-hydroxy-4-formyl-5-hydroxymethylpyridine hydrochloride | ChemIDplus |
| 3-Hydroxy-5-(hydroxymethyl)-2-methylisonicotinaldehyde, hydrochloride | ChemIDplus |
| Pyridoxal HCl | ChemIDplus |
| Vitamin B6 hydrochloride | ChemIDplus |
| Citations |
|---|