EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33NO2 |
| Net Charge | 0 |
| Average Mass | 379.544 |
| Monoisotopic Mass | 379.25113 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/Cc1c(O)c(C)[n+]([O-])c2ccccc12 |
| InChI | InChI=1S/C25H33NO2/c1-18(2)10-8-11-19(3)12-9-13-20(4)16-17-23-22-14-6-7-15-24(22)26(28)21(5)25(23)27/h6-7,10,12,14-16,27H,8-9,11,13,17H2,1-5H3/b19-12+,20-16+ |
| InChIKey | ZNSLRZHNFFXDSE-YEFHWUCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stigmatella aurantiaca Sg a15 (ncbitaxon:675526) | - | PubMed (21979787) | Strain: Sg a15 |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aurachin B (CHEBI:131528) has role bacterial metabolite (CHEBI:76969) |
| aurachin B (CHEBI:131528) is a A-type aurachin (CHEBI:90917) |
| aurachin B (CHEBI:131528) is a heteroaryl hydroxy compound (CHEBI:74818) |
| aurachin B (CHEBI:131528) is a olefinic compound (CHEBI:78840) |
| aurachin B (CHEBI:131528) is a quinoline N-oxide (CHEBI:26508) |
| aurachin B (CHEBI:131528) is conjugate acid of aurachin B(1−) (CHEBI:90784) |
| Incoming Relation(s) |
| aurachin B(1−) (CHEBI:90784) is conjugate base of aurachin B (CHEBI:131528) |
| IUPAC Name |
|---|
| 2-methyl-1-oxo-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-1λ5-quinolin-3-ol |
| Synonym | Source |
|---|---|
| Aurachin B | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:108354-12-7 | KNApSAcK |
| CAS:108354-12-7 | ChemIDplus |
| Citations |
|---|