EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131526 - potassium carbonate
| Formula | CO3.2K |
| Net Charge | 0 |
| Average Mass | 138.204 |
| Monoisotopic Mass | 137.91216 |
| SMILES | O=C([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/CH2O3.2K/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 |
| InChIKey | BWHMMNNQKKPAPP-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| Applications: | flame retardant Any compound that is added to manufactured materials to inhibit, suppress, or delay the production of flames and so prevent the spread of fire. fertilizer A fertilizer is any substance that is added to soil or water to assist the growth of plants. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium carbonate (CHEBI:131526) has role catalyst (CHEBI:35223) |
| potassium carbonate (CHEBI:131526) has role fertilizer (CHEBI:33287) |
| potassium carbonate (CHEBI:131526) has role flame retardant (CHEBI:79314) |
| potassium carbonate (CHEBI:131526) is a carbonate salt (CHEBI:46721) |
| potassium carbonate (CHEBI:131526) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| dipotassium carbonate |
| Synonyms | Source |
|---|---|
| Carbonate of potash | ChemIDplus |
| Carbonic acid, dipotassium salt | ChemIDplus |
| Kaliumcarbonat | ChemIDplus |
| K2CO3 | ChEBI |
| Potassium carbonate, anhydrous | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D02038 | KEGG DRUG |
| Potassium_carbonate | Wikipedia |
| Citations |
|---|