EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131526 - potassium carbonate
| Formula | CO3.2K |
| Net Charge | 0 |
| Average Mass | 138.204 |
| Monoisotopic Mass | 137.91216 |
| SMILES | O=C([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/CH2O3.2K/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 |
| InChIKey | BWHMMNNQKKPAPP-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| Applications: | fertilizer A fertilizer is any substance that is added to soil or water to assist the growth of plants. flame retardant Any compound that is added to manufactured materials to inhibit, suppress, or delay the production of flames and so prevent the spread of fire. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium carbonate (CHEBI:131526) has role catalyst (CHEBI:35223) |
| potassium carbonate (CHEBI:131526) has role fertilizer (CHEBI:33287) |
| potassium carbonate (CHEBI:131526) has role flame retardant (CHEBI:79314) |
| potassium carbonate (CHEBI:131526) is a carbonate salt (CHEBI:46721) |
| potassium carbonate (CHEBI:131526) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| dipotassium carbonate |
| Synonyms | Source |
|---|---|
| K2CO3 | ChEBI |
| Carbonic acid, dipotassium salt | ChemIDplus |
| Carbonate of potash | ChemIDplus |
| Kaliumcarbonat | ChemIDplus |
| Potassium carbonate, anhydrous | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D02038 | KEGG DRUG |
| Potassium_carbonate | Wikipedia |
| Citations |
|---|