EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13BrN4O |
| Net Charge | 0 |
| Average Mass | 369.222 |
| Monoisotopic Mass | 368.02727 |
| SMILES | C=CC(=O)Nc1ccc2ncnc(Nc3cccc(Br)c3)c2c1 |
| InChI | InChI=1S/C17H13BrN4O/c1-2-16(23)21-13-6-7-15-14(9-13)17(20-10-19-15)22-12-5-3-4-11(18)8-12/h2-10H,1H2,(H,21,23)(H,19,20,22) |
| InChIKey | HTUBKQUPEREOGA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PD 168393 (CHEBI:131504) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| PD 168393 (CHEBI:131504) is a acrylamides (CHEBI:22216) |
| PD 168393 (CHEBI:131504) is a bromobenzenes (CHEBI:37149) |
| PD 168393 (CHEBI:131504) is a quinazolines (CHEBI:38530) |
| PD 168393 (CHEBI:131504) is a secondary carboxamide (CHEBI:140325) |
| PD 168393 (CHEBI:131504) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| N-[4-(3-bromoanilino)quinazolin-6-yl]prop-2-enamide |
| Synonyms | Source |
|---|---|
| PD168393 | ChemIDplus |
| 4-[(3-bromophenyl)amino]-6-acrylamidoquinazoline | ChEBI |
| PD-168393 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8341355 | Reaxys |
| CAS:194423-15-9 | ChemIDplus |
| Citations |
|---|