EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32N2O5 |
| Net Charge | 0 |
| Average Mass | 368.474 |
| Monoisotopic Mass | 368.23112 |
| SMILES | O=C(O)CCCCCC[C@@H]1C(=O)NC(=O)N1CC[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C19H32N2O5/c22-16(14-8-4-3-5-9-14)12-13-21-15(18(25)20-19(21)26)10-6-1-2-7-11-17(23)24/h14-16,22H,1-13H2,(H,23,24)(H,20,25,26)/t15-,16+/m1/s1 |
| InChIKey | ZIDQIOZJEJFMOH-CVEARBPZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,4R)-BW 245C (CHEBI:131501) is a 7-[3-(3-cyclohexyl-3-hydroxypropyl)-2,5-dioxoimidazolidin-4-yl]heptanoic acid (CHEBI:131502) |
| (3S,4R)-BW 245C (CHEBI:131501) is enantiomer of (3R,4S)-BW 245C (CHEBI:131500) |
| Incoming Relation(s) |
| BW 245C (CHEBI:131496) has part (3S,4R)-BW 245C (CHEBI:131501) |
| (3R,4S)-BW 245C (CHEBI:131500) is enantiomer of (3S,4R)-BW 245C (CHEBI:131501) |
| IUPAC Name |
|---|
| 7-{(4R)-3-[(3S)-3-cyclohexyl-3-hydroxypropyl]-2,5-dioxoimidazolidin-4-yl}heptanoic acid |
| Synonym | Source |
|---|---|
| (S-(R*,S*))-3-(3-Cyclohexyl-3-hydroxypropyl)-2,5-dioxoimidazolidine-4-heptanoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5304906 | Reaxys |
| CAS:78420-16-3 | ChemIDplus |