EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O17 |
| Net Charge | 0 |
| Average Mass | 626.520 |
| Monoisotopic Mass | 626.14830 |
| SMILES | O=c1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(-c2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C27H30O17/c28-6-14-17(33)20(36)22(38)26(42-14)41-12-2-1-8(3-10(12)31)24-25(19(35)16-11(32)4-9(30)5-13(16)40-24)44-27-23(39)21(37)18(34)15(7-29)43-27/h1-5,14-15,17-18,20-23,26-34,36-39H,6-7H2/t14-,15-,17-,18-,20+,21+,22-,23-,26-,27+/m1/s1 |
| InChIKey | RPVIQWDFJPYNJM-DEFKTLOSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allium cepa (ncbitaxon:4679) | - | PubMed (23656415) | |
| Solanum habrochaites (ncbitaxon:62890) | - | MetaboLights (MTBLS297) | |
| Solanum lycopersicum (ncbitaxon:4081) | - | MetaboLights (MTBLS297) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercetin 3,4'-di-O-β-D-glucoside (CHEBI:131498) has role cardioprotective agent (CHEBI:77307) |
| quercetin 3,4'-di-O-β-D-glucoside (CHEBI:131498) has role plant metabolite (CHEBI:76924) |
| quercetin 3,4'-di-O-β-D-glucoside (CHEBI:131498) has role radical scavenger (CHEBI:48578) |
| quercetin 3,4'-di-O-β-D-glucoside (CHEBI:131498) is a monosaccharide derivative (CHEBI:63367) |
| quercetin 3,4'-di-O-β-D-glucoside (CHEBI:131498) is a polyphenol (CHEBI:26195) |
| quercetin 3,4'-di-O-β-D-glucoside (CHEBI:131498) is a quercetin O-glucoside (CHEBI:64621) |
| quercetin 3,4'-di-O-β-D-glucoside (CHEBI:131498) is a trihydroxyflavone (CHEBI:27116) |
| quercetin 3,4'-di-O-β-D-glucoside (CHEBI:131498) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-[3-(β-D-glucopyranosyloxy)-5,7-dihydroxy-4-oxo-4H-1-benzopyran-2-yl]-2-hydroxyphenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Quercetin 3,4'-diglucoside | LIPID MAPS |
| Quercetin 3,4'-di-O-beta-D-glucopyranoside | KNApSAcK |
| quercetin 3,4'-O-diglucoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4478806 | ChemSpider |
| C00005436 | KNApSAcK |
| CPD-14753 | MetaCyc |
| HMDB0037363 | HMDB |
| LMPK12112104 | LIPID MAPS |
| Quercetin_3,4%27-diglucoside | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4345290 | Reaxys |
| CAS:29125-80-2 | KNApSAcK |
| Citations |
|---|