EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20N2O5 |
| Net Charge | 0 |
| Average Mass | 404.422 |
| Monoisotopic Mass | 404.13722 |
| SMILES | COc1cc(C=NNC(=O)c2ccc3c(c2)OCO3)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H20N2O5/c1-27-21-11-17(7-9-19(21)28-14-16-5-3-2-4-6-16)13-24-25-23(26)18-8-10-20-22(12-18)30-15-29-20/h2-13H,14-15H2,1H3,(H,25,26) |
| InChIKey | ULOKADSYVZOTTL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | formyl peptide receptor agonist An agonist that binds to and activates formyl peptide receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FPR A14 (CHEBI:131493) has role formyl peptide receptor agonist (CHEBI:131495) |
| FPR A14 (CHEBI:131493) is a benzodioxoles (CHEBI:38298) |
| FPR A14 (CHEBI:131493) is a benzyl ether (CHEBI:59859) |
| FPR A14 (CHEBI:131493) is a hydrazone (CHEBI:38532) |
| FPR A14 (CHEBI:131493) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| N1-{[4-(benzyloxy)-3-methoxyphenyl]methylidene}-2H-1,3-benzodioxole-5-carbohydrazide |
| Synonym | Source |
|---|---|
| 1,3-benzodioxolane-5-carboxylic acid 4'-benzyloxy-3'-methoxybenzylidene hydrazide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18600659 | Reaxys |