EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10BrN3O |
| Net Charge | 0 |
| Average Mass | 328.169 |
| Monoisotopic Mass | 327.00072 |
| SMILES | O=C1Cc2c(nc3ccc(Br)cc23)-c2ncccc2N1 |
| InChI | InChI=1S/C15H10BrN3O/c16-8-3-4-11-9(6-8)10-7-13(20)18-12-2-1-5-17-15(12)14(10)19-11/h1-6,19H,7H2,(H,18,20) |
| InChIKey | NTSBZVCEIVPKBJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | Wnt signalling activator A substance that activates any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-azakenpaullone (CHEBI:131490) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| 1-azakenpaullone (CHEBI:131490) has role Wnt signalling activator (CHEBI:131492) |
| 1-azakenpaullone (CHEBI:131490) is a lactam (CHEBI:24995) |
| 1-azakenpaullone (CHEBI:131490) is a organic heterotetracyclic compound (CHEBI:38163) |
| 1-azakenpaullone (CHEBI:131490) is a organobromine compound (CHEBI:37141) |
| 1-azakenpaullone (CHEBI:131490) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| IUPAC Name |
|---|
| 9-bromo-7,12-dihydropyrido[3',2':2,3]azepino[4,5-b]indol-6(5H)-one |
| Synonym | Source |
|---|---|
| 1-AKP | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9571784 | Reaxys |
| Citations |
|---|