EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O2S |
| Net Charge | 0 |
| Average Mass | 158.222 |
| Monoisotopic Mass | 158.04015 |
| SMILES | CC(=O)SC1=C(C)OCC1 |
| InChI | InChI=1S/C7H10O2S/c1-5-7(3-4-9-5)10-6(2)8/h3-4H2,1-2H3 |
| InChIKey | YDYAMYYOQBGPRX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (25502724) | ||
| - | MetaboLights (MTBLS93) |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(4,5-dihydro-2-methyl-3-furanyl) ethanethioate (CHEBI:131456) has role flavouring agent (CHEBI:35617) |
| S-(4,5-dihydro-2-methyl-3-furanyl) ethanethioate (CHEBI:131456) is a dihydrofuran (CHEBI:51659) |
| S-(4,5-dihydro-2-methyl-3-furanyl) ethanethioate (CHEBI:131456) is a thioacetate ester (CHEBI:52477) |
| IUPAC Name |
|---|
| S-(2-methyl-4,5-dihydrofuran-3-yl) ethanethioate |
| Synonyms | Source |
|---|---|
| 2-Methyl-3-thioacetoxy-4,5-dihydrofuran | HMDB |
| 2-Methyl-4,5-dihydro-3-furanthiol acetate | HMDB |
| S-(4,5-Dihydro-2-methyl-3-furyl) thioacetate | HMDB |
| Ethanethioic acid, S-(4,5-dihydro-2-methyl-3-furanyl) ester | HMDB |
| 2-Methyl-3-(thioacetoxy)-4,5-dihydrofuran | HMDB |
| 4,5-Dihydro-2-methyl-3-furanthiyl acetate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0037786 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:26486-14-6 | ChemIDplus |