EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23O12 |
| Net Charge | +1 |
| Average Mass | 491.425 |
| Monoisotopic Mass | 491.11840 |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H22O12/c1-9(24)32-8-18-19(29)20(30)21(31)23(35-18)34-17-7-12-14(27)5-11(25)6-16(12)33-22(17)10-2-3-13(26)15(28)4-10/h2-7,18-21,23,29-31H,8H2,1H3,(H3-,25,26,27,28)/p+1/t18-,19-,20+,21-,23-/m1/s1 |
| InChIKey | HBXXDBKJLPLXPR-ZFVIQDPVSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllanthus niruri (ncbitaxon:296034) | - | MetaboLights (MTBLS224) | |
| Vitis vinifera (ncbitaxon:29760) | |||
| - | PubMed (23759170) | ||
| - | MetaboLights (MTBLS39) | ||
| - | DOI (10.1007/s11306-010-0259-y) | ||
| - | PubMed (20826702) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyanidin 3-O-(6-O-acetyl-β-D-glucoside) (CHEBI:131449) has functional parent cyanidin cation (CHEBI:27843) |
| cyanidin 3-O-(6-O-acetyl-β-D-glucoside) (CHEBI:131449) has role plant metabolite (CHEBI:76924) |
| cyanidin 3-O-(6-O-acetyl-β-D-glucoside) (CHEBI:131449) is a acetate ester (CHEBI:47622) |
| cyanidin 3-O-(6-O-acetyl-β-D-glucoside) (CHEBI:131449) is a anthocyanin cation (CHEBI:35218) |
| cyanidin 3-O-(6-O-acetyl-β-D-glucoside) (CHEBI:131449) is a monosaccharide derivative (CHEBI:63367) |
| cyanidin 3-O-(6-O-acetyl-β-D-glucoside) (CHEBI:131449) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-1-benzopyran-1-ium-3-yl 6-O-acetyl-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Cyanidin 3-(6''-acetylglucoside) | KNApSAcK |
| Cyanidin 3-(6''-acetylglucoside) | LIPID MAPS |
| cyanidin 3-O-(6''-acetylglucoside) | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00006793 | KNApSAcK |
| LMPK12010132 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9601842 | Reaxys |
| CAS:133080-31-6 | KNApSAcK |
| Citations |
|---|