EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO2S |
| Net Charge | 0 |
| Average Mass | 177.269 |
| Monoisotopic Mass | 177.08235 |
| SMILES | CCOC(=O)[C@@H](N)CCSC |
| InChI | InChI=1S/C7H15NO2S/c1-3-10-7(9)6(8)4-5-11-2/h6H,3-5,8H2,1-2H3/t6-/m0/s1 |
| InChIKey | ARJXIGOIOGJAKR-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS298) | ||
| - | PubMed (26839171) |
| Roles Classification |
|---|
| Biological Role: | potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl L-methioninate (CHEBI:131435) has role potassium channel blocker (CHEBI:50509) |
| ethyl L-methioninate (CHEBI:131435) is a L-methionine derivative (CHEBI:84121) |
| ethyl L-methioninate (CHEBI:131435) is a α-amino acid ester (CHEBI:46874) |
| IUPAC Name |
|---|
| ethyl L-methioninate |
| Synonyms | Source |
|---|---|
| ethyl (2S)-2-amino-4-(methylsulfanyl)butanoate | IUPAC |
| ethyl methioninate | ChEBI |
| methionine ethyl ester | ChEBI |
| Met-OEt | ChEBI |
| L-methionine ethyl ester | ChEBI |
| L-Met-OEt | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 68978 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723124 | Reaxys |
| Citations |
|---|