EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | CC(C(=O)O)c1cccc(O)c1 |
| InChI | InChI=1S/C9H10O3/c1-6(9(11)12)7-3-2-4-8(10)5-7/h2-6,10H,1H3,(H,11,12) |
| InChIKey | BYRVXROVZBYNOZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS298) | ||
| - | PubMed (26839171) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(3-hydroxyphenyl)propionic acid (CHEBI:131432) has functional parent hydratropic acid (CHEBI:48526) |
| 2-(3-hydroxyphenyl)propionic acid (CHEBI:131432) is a 2-arylpropionic acid (CHEBI:16333) |
| 2-(3-hydroxyphenyl)propionic acid (CHEBI:131432) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-(3-hydroxyphenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| 2-(m-hydroxyphenyl)propanoic acid | ChEBI |
| 2-(m-hydroxyphenyl)propionic acid | ChEBI |
| 3-hydroxyhydratropic acid | ChEBI |
| m-hydroxyhydratropic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 11219106 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3048658 | Reaxys |