EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | O=C(O)Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C8H8O4/c9-6-1-5(3-8(11)12)2-7(10)4-6/h1-2,4,9-10H,3H2,(H,11,12) |
| InChIKey | IOVOJJDSFSXJQN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (26839171) | ||
| - | MetaboLights (MTBLS298) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS298) | From MetaboLights |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3,5-dihydroxyphenyl)acetic acid (CHEBI:131431) has functional parent phenylacetic acid (CHEBI:30745) |
| (3,5-dihydroxyphenyl)acetic acid (CHEBI:131431) has role drug metabolite (CHEBI:49103) |
| (3,5-dihydroxyphenyl)acetic acid (CHEBI:131431) is a monocarboxylic acid (CHEBI:25384) |
| (3,5-dihydroxyphenyl)acetic acid (CHEBI:131431) is a phenylacetic acids (CHEBI:25978) |
| (3,5-dihydroxyphenyl)acetic acid (CHEBI:131431) is a resorcinols (CHEBI:33572) |
| (3,5-dihydroxyphenyl)acetic acid (CHEBI:131431) is conjugate acid of (3,5-dihydroxyphenyl)acetate (CHEBI:189559) |
| Incoming Relation(s) |
| (3,5-dihydroxyphenyl)acetate (CHEBI:189559) is conjugate base of (3,5-dihydroxyphenyl)acetic acid (CHEBI:131431) |
| IUPAC Name |
|---|
| (3,5-dihydroxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 2-(3,5-dihydroxyphenyl)acetic acid | ChEBI |
| 3,5-dihydroxyphenylacetic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 519640 | ChemSpider |
| HMDB0094709 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2691778 | Reaxys |
| CAS:4670-09-1 | ChemIDplus |
| Citations |
|---|