EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131424 - (2-ethoxyethoxy)acetic acid
| Formula | C6H12O4 |
| Net Charge | 0 |
| Average Mass | 148.158 |
| Monoisotopic Mass | 148.07356 |
| SMILES | CCOCCOCC(=O)O |
| InChI | InChI=1S/C6H12O4/c1-2-9-3-4-10-5-6(7)8/h2-5H2,1H3,(H,7,8) |
| InChIKey | LVLQKFRSMSHJIE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (26839171) | ||
| - | MetaboLights (MTBLS298) | ||
| urine (BTO:0001419) | PubMed (872440) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-ethoxyethoxy)acetic acid (CHEBI:131424) has role human urinary metabolite (CHEBI:84087) |
| (2-ethoxyethoxy)acetic acid (CHEBI:131424) is a diether (CHEBI:46786) |
| (2-ethoxyethoxy)acetic acid (CHEBI:131424) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2-ethoxyethoxy)acetic acid |
| Synonym | Source |
|---|---|
| β-ethoxyethoxyacetic acid | ChEBI |
| Citations |
|---|