EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22O |
| Net Charge | 0 |
| Average Mass | 206.329 |
| Monoisotopic Mass | 206.16707 |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1O |
| InChI | InChI=1S/C14H22O/c1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6/h7-9,15H,1-6H3 |
| InChIKey | DKCPKDPYUFEZCP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS298) | ||
| - | PubMed (26839171) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-di-tert-butylphenol (CHEBI:131421) has role antioxidant (CHEBI:22586) |
| 2,6-di-tert-butylphenol (CHEBI:131421) is a alkylbenzene (CHEBI:38976) |
| 2,6-di-tert-butylphenol (CHEBI:131421) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,6-di-tert-butylphenol |
| Synonyms | Source |
|---|---|
| 2,6-Di-t-butylphenol | ChemIDplus |
| 2,6-Bis(tert-butyl)phenol | ChemIDplus |
| 2,6-Bis(1,1-dimethylethyl)phenol | ChemIDplus |
| 2,6-Bis(t-butyl)phenol | NIST Chemistry WebBook |
| 2,6-(1,1-Dimethylethyl)phenol | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 29135 | ChemSpider |
| 2,6-Di-tert-butylphenol | Wikipedia |
| Citations |
|---|