EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14ClNO |
| Net Charge | 0 |
| Average Mass | 151.637 |
| Monoisotopic Mass | 151.07639 |
| SMILES | CCN(CCO)CCCl |
| InChI | InChI=1S/C6H14ClNO/c1-2-8(4-3-7)5-6-9/h9H,2-6H2,1H3 |
| InChIKey | ODCWAALEHCNIBY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS298) | ||
| - | PubMed (26839171) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chloro-2'-hydroxytriethylamine (CHEBI:131420) has functional parent ethanolamine (CHEBI:16000) |
| 2-chloro-2'-hydroxytriethylamine (CHEBI:131420) is a organochlorine compound (CHEBI:36683) |
| 2-chloro-2'-hydroxytriethylamine (CHEBI:131420) is a primary alcohol (CHEBI:15734) |
| 2-chloro-2'-hydroxytriethylamine (CHEBI:131420) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-[(2-chloroethyl)(ethyl)amino]ethan-1-ol |
| Synonyms | Source |
|---|---|
| 2-((2-Chloroethyl)ethylamino)ethanol | ChemIDplus |
| 2'-chloro-2-hydroxytriethylamine | ChEBI |
| Ethylcholine mustard | ChemIDplus |