EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O2 |
| Net Charge | 0 |
| Average Mass | 256.430 |
| Monoisotopic Mass | 256.24023 |
| SMILES | CCC(C)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O2/c1-3-15(2)13-11-9-7-5-4-6-8-10-12-14-16(17)18/h15H,3-14H2,1-2H3,(H,17,18) |
| InChIKey | WWASUAHHCLARMF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Papio cynocephalus (ncbitaxon:9556) | - | PubMed (115510) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-methylpentadecanoic acid (CHEBI:131414) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| 13-methylpentadecanoic acid (CHEBI:131414) has role mammalian metabolite (CHEBI:75768) |
| 13-methylpentadecanoic acid (CHEBI:131414) is a long-chain fatty acid (CHEBI:15904) |
| 13-methylpentadecanoic acid (CHEBI:131414) is a methyl-branched fatty acid (CHEBI:62499) |
| 13-methylpentadecanoic acid (CHEBI:131414) is a saturated fatty acid (CHEBI:26607) |
| IUPAC Name |
|---|
| 13-methylpentadecanoic acid |
| Synonyms | Source |
|---|---|
| C15:0-13-methyl | ChEBI |
| Anteisopalmitic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1707799 | Reaxys |
| CAS:20121-96-4 | ChemIDplus |
| CAS:20121-96-4 | NIST Chemistry WebBook |
| Citations |
|---|